C20H20N2O5 — CID 2788119
3-(1,3-benzodioxol-5-yl)-N'-[2-(3,5-dimethylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 2788119) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N'-[2-(3,5-dimethylphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N'-[2-(3,5-dimethylphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 2788119 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N'-[2-(3,5-dimethylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | Cc1cc(C)cc(OCC(=O)NNC(=O)C=Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-13-7-14(2)9-16(8-13)25-11-20(24)22-21-19(23)6-4-15-3-5-17-18(10-15)27-12-26-17/h3-10H,11-12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | DPKVGGLOKXMQOI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|