C20H17N3O5 — CID 9471674
(E)-N'-[2-(4-cyanophenoxy)acetyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enehydrazide (PubChem CID 9471674) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is (E)-N'-[2-(4-cyanophenoxy)acetyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(4-cyanophenoxy)acetyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9471674 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (E)-N'-[2-(4-cyanophenoxy)acetyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enehydrazide |
| SMILES | N#Cc1ccc(OCC(=O)NNC(=O)/C=C/c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C20H17N3O5/c21-12-15-1-5-16(6-2-15)28-13-20(25)23-22-19(24)8-4-14-3-7-17-18(11-14)27-10-9-26-17/h1-8,11H,9-10,13H2,(H,22,24)(H,23,25)/b8-4+ |
| InChIKey | TVCFLICMLLWUJB-XBXARRHUSA-N |
| XLogP | 1.57 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|