C20H18ClN3O5 — CID 9471671
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N'-[2-(4-cyanophenoxy)acetyl]prop-2-enehydrazide (PubChem CID 9471671) has the molecular formula C20H18ClN3O5 and a molecular weight of 415.83 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N'-[2-(4-cyanophenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N'-[2-(4-cyanophenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9471671 |
| Molecular Formula | C20H18ClN3O5 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N'-[2-(4-cyanophenoxy)acetyl]prop-2-enehydrazide |
| SMILES | COc1cc(/C=C/C(=O)NNC(=O)COc2ccc(C#N)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H18ClN3O5/c1-27-17-10-14(9-16(21)20(17)28-2)5-8-18(25)23-24-19(26)12-29-15-6-3-13(11-22)4-7-15/h3-10H,12H2,1-2H3,(H,23,25)(H,24,26)/b8-5+ |
| InChIKey | UMTNYYYOMBVFOT-VMPITWQZSA-N |
| XLogP | 2.47 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|