C22H26N2O6 — CID 7943419
(E)-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enehydrazide (PubChem CID 7943419) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is (E)-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 7943419 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (E)-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enehydrazide |
| SMILES | COc1cc(/C=C/C(=O)NNC(=O)COc2cc(C)ccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C22H26N2O6/c1-14-6-7-15(2)17(10-14)30-13-21(26)24-23-20(25)9-8-16-11-18(27-3)22(29-5)19(12-16)28-4/h6-12H,13H2,1-5H3,(H,23,25)(H,24,26)/b9-8+ |
| InChIKey | FOOYWWCJPUVJET-CMDGGOBGSA-N |
| XLogP | 2.57 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|