C23H27ClN2O5 — CID 30862457
(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]prop-2-enamide (PubChem CID 30862457) has the molecular formula C23H27ClN2O5 and a molecular weight of 446.93 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 30862457 |
| Molecular Formula | C23H27ClN2O5 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]prop-2-enamide |
| SMILES | CCCOc1c(Cl)cc(/C=C/C(=O)Nc2ccc(OCC(=O)NCC)cc2)cc1OC |
| InChI | InChI=1S/C23H27ClN2O5/c1-4-12-30-23-19(24)13-16(14-20(23)29-3)6-11-21(27)26-17-7-9-18(10-8-17)31-15-22(28)25-5-2/h6-11,13-14H,4-5,12,15H2,1-3H3,(H,25,28)(H,26,27)/b11-6+ |
| InChIKey | OMQFMEYGQWKPDT-IZZDOVSWSA-N |
| XLogP | 4.30 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|