C23H23ClN2O4 — CID 55836151
(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]prop-2-enamide (PubChem CID 55836151) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55836151 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]prop-2-enamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)/C=C/c2cc(Cl)c(OCCC)c(OC)c2)c1 |
| InChI | InChI=1S/C23H23ClN2O4/c1-4-11-30-23-19(24)13-17(14-20(23)29-3)9-10-21(27)25-15-22(28)26-18-8-6-7-16(5-2)12-18/h2,6-10,12-14H,4,11,15H2,1,3H3,(H,25,27)(H,26,28)/b10-9+ |
| InChIKey | OAHALJVCTVUHNW-MDZDMXLPSA-N |
| XLogP | 3.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|