C25H26ClN3O5 — CID 55526569
(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]prop-2-enamide (PubChem CID 55526569) has the molecular formula C25H26ClN3O5 and a molecular weight of 483.95 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55526569 |
| Molecular Formula | C25H26ClN3O5 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]prop-2-enamide |
| SMILES | CCCOc1c(Cl)cc(/C=C/C(=O)Nc2ccc(NC(=O)NCc3ccco3)cc2)cc1OC |
| InChI | InChI=1S/C25H26ClN3O5/c1-3-12-34-24-21(26)14-17(15-22(24)32-2)6-11-23(30)28-18-7-9-19(10-8-18)29-25(31)27-16-20-5-4-13-33-20/h4-11,13-15H,3,12,16H2,1-2H3,(H,28,30)(H2,27,29,31)/b11-6+ |
| InChIKey | HLGQIOCLIABBFO-IZZDOVSWSA-N |
| XLogP | 5.70 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|