C24H30ClN3O4 — CID 55706399
3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]prop-2-enamide (PubChem CID 55706399) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is 3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]prop-2-enamide.
| Compound Name | 3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55706399 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]prop-2-enamide |
| SMILES | CCCOc1c(Cl)cc(C=CC(=O)NCc2ccc(NC(=O)NC(C)C)cc2)cc1OC |
| InChI | InChI=1S/C24H30ClN3O4/c1-5-12-32-23-20(25)13-18(14-21(23)31-4)8-11-22(29)26-15-17-6-9-19(10-7-17)28-24(30)27-16(2)3/h6-11,13-14,16H,5,12,15H2,1-4H3,(H,26,29)(H2,27,28,30) |
| InChIKey | NVXYJLWLSURBGF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|