C19H22N4O2 — CID 60556286
(E)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]-3-pyridin-4-ylprop-2-enamide (PubChem CID 60556286) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (E)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]-3-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 60556286 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (E)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]-3-pyridin-4-ylprop-2-enamide |
| SMILES | CC(C)NC(=O)Nc1ccc(CNC(=O)/C=C/c2ccncc2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-14(2)22-19(25)23-17-6-3-16(4-7-17)13-21-18(24)8-5-15-9-11-20-12-10-15/h3-12,14H,13H2,1-2H3,(H,21,24)(H2,22,23,25)/b8-5+ |
| InChIKey | DYTNJANHBJUNLF-VMPITWQZSA-N |
| XLogP | 2.94 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|