C15H13ClN2O — CID 895858
3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)prop-2-enamide (PubChem CID 895858) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 895858 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)NCc1ccncc1 |
| InChI | InChI=1S/C15H13ClN2O/c16-14-4-1-12(2-5-14)3-6-15(19)18-11-13-7-9-17-10-8-13/h1-10H,11H2,(H,18,19) |
| InChIKey | FBVVKTBESJQWSV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|