C22H20ClN3O — CID 154081844
3-(4-chlorophenyl)-N-[[4-[methyl(pyridin-4-yl)amino]phenyl]methyl]prop-2-enamide (PubChem CID 154081844) has the molecular formula C22H20ClN3O and a molecular weight of 377.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[[4-[methyl(pyridin-4-yl)amino]phenyl]methyl]prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-[[4-[methyl(pyridin-4-yl)amino]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 154081844 |
| Molecular Formula | C22H20ClN3O |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[[4-[methyl(pyridin-4-yl)amino]phenyl]methyl]prop-2-enamide |
| SMILES | CN(c1ccncc1)c1ccc(CNC(=O)C=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H20ClN3O/c1-26(21-12-14-24-15-13-21)20-9-4-18(5-10-20)16-25-22(27)11-6-17-2-7-19(23)8-3-17/h2-15H,16H2,1H3,(H,25,27) |
| InChIKey | QMLMXUWKWXPFLG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|