C19H21ClN2O4S — CID 108759033
(E)-3-(4-chlorophenyl)-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]prop-2-enamide (PubChem CID 108759033) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108759033 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]prop-2-enamide |
| SMILES | COCCNS(=O)(=O)c1ccc(CNC(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H21ClN2O4S/c1-26-13-12-22-27(24,25)18-9-4-16(5-10-18)14-21-19(23)11-6-15-2-7-17(20)8-3-15/h2-11,22H,12-14H2,1H3,(H,21,23)/b11-6+ |
| InChIKey | GWUZYWUODGRULU-IZZDOVSWSA-N |
| XLogP | 2.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|