C13H22ClN3O4S — CID 119296315
3-amino-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]propanamide;hydrochloride (PubChem CID 119296315) has the molecular formula C13H22ClN3O4S and a molecular weight of 351.86 g/mol. Its IUPAC name is 3-amino-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119296315 |
| Molecular Formula | C13H22ClN3O4S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-amino-N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]propanamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1ccc(CNC(=O)CCN)cc1.Cl |
| InChI | InChI=1S/C13H21N3O4S.ClH/c1-20-9-8-16-21(18,19)12-4-2-11(3-5-12)10-15-13(17)6-7-14;/h2-5,16H,6-10,14H2,1H3,(H,15,17);1H |
| InChIKey | JDVGEEQQCQCKKY-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|