C16H13BrClNO — CID 63529144
(E)-N-[(4-bromophenyl)methyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 63529144) has the molecular formula C16H13BrClNO and a molecular weight of 350.64 g/mol. Its IUPAC name is (E)-N-[(4-bromophenyl)methyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4-bromophenyl)methyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 63529144 |
| Molecular Formula | C16H13BrClNO |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (E)-N-[(4-bromophenyl)methyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H13BrClNO/c17-14-6-1-13(2-7-14)11-19-16(20)10-5-12-3-8-15(18)9-4-12/h1-10H,11H2,(H,19,20)/b10-5+ |
| InChIKey | QUULIVXOPIRUHP-BJMVGYQFSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|