C16H15BrN2O3S — CID 3477779
3-(4-bromophenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide (PubChem CID 3477779) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide.
| Compound Name | 3-(4-bromophenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 3477779 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 3-(4-bromophenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C=Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H15BrN2O3S/c17-14-6-1-12(2-7-14)5-10-16(20)19-11-13-3-8-15(9-4-13)23(18,21)22/h1-10H,11H2,(H,19,20)(H2,18,21,22) |
| InChIKey | DAUYYGPTHPBGIH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|