C17H17BrN2O3S — CID 9165843
(E)-3-(2-bromophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide (PubChem CID 9165843) has the molecular formula C17H17BrN2O3S and a molecular weight of 409.31 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-bromophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9165843 |
| Molecular Formula | C17H17BrN2O3S |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | (E)-3-(2-bromophenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)/C=C/c2ccccc2Br)cc1 |
| InChI | InChI=1S/C17H17BrN2O3S/c18-16-4-2-1-3-14(16)7-10-17(21)20-12-11-13-5-8-15(9-6-13)24(19,22)23/h1-10H,11-12H2,(H,20,21)(H2,19,22,23)/b10-7+ |
| InChIKey | VZXKJCXOHCXOPC-JXMROGBWSA-N |
| XLogP | 2.47 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|