C19H18ClN5O3S2 — CID 6478824
(E)-3-(2-chlorophenyl)-N-[5-[2-(4-sulfamoylphenyl)ethylamino]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 6478824) has the molecular formula C19H18ClN5O3S2 and a molecular weight of 463.97 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[5-[2-(4-sulfamoylphenyl)ethylamino]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[5-[2-(4-sulfamoylphenyl)ethylamino]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6478824 |
| Molecular Formula | C19H18ClN5O3S2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[5-[2-(4-sulfamoylphenyl)ethylamino]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2nnc(NC(=O)/C=C/c3ccccc3Cl)s2)cc1 |
| InChI | InChI=1S/C19H18ClN5O3S2/c20-16-4-2-1-3-14(16)7-10-17(26)23-19-25-24-18(29-19)22-12-11-13-5-8-15(9-6-13)30(21,27)28/h1-10H,11-12H2,(H,22,24)(H2,21,27,28)(H,23,25,26)/b10-7+ |
| InChIKey | NWSMOKGGUWXEMN-JXMROGBWSA-N |
| XLogP | 3.15 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|