C17H20ClN5OS — CID 6478885
(E)-3-(2-chlorophenyl)-N-[5-(2-pyrrolidin-1-ylethylamino)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 6478885) has the molecular formula C17H20ClN5OS and a molecular weight of 377.90 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[5-(2-pyrrolidin-1-ylethylamino)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[5-(2-pyrrolidin-1-ylethylamino)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6478885 |
| Molecular Formula | C17H20ClN5OS |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[5-(2-pyrrolidin-1-ylethylamino)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1nnc(NCCN2CCCC2)s1 |
| InChI | InChI=1S/C17H20ClN5OS/c18-14-6-2-1-5-13(14)7-8-15(24)20-17-22-21-16(25-17)19-9-12-23-10-3-4-11-23/h1-2,5-8H,3-4,9-12H2,(H,19,21)(H,20,22,24)/b8-7+ |
| InChIKey | LHKCOYCZAOLZAQ-BQYQJAHWSA-N |
| XLogP | 3.35 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|