C21H16Cl2N4O2S — CID 17203498
(E)-3-(2-chlorophenyl)-N-[5-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 17203498) has the molecular formula C21H16Cl2N4O2S and a molecular weight of 459.36 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[5-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[5-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17203498 |
| Molecular Formula | C21H16Cl2N4O2S |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[5-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1nnc(C2CC(=O)N(c3ccc(Cl)cc3)C2)s1 |
| InChI | InChI=1S/C21H16Cl2N4O2S/c22-15-6-8-16(9-7-15)27-12-14(11-19(27)29)20-25-26-21(30-20)24-18(28)10-5-13-3-1-2-4-17(13)23/h1-10,14H,11-12H2,(H,24,26,28)/b10-5+ |
| InChIKey | ZKFMBPSSXNLTJI-BJMVGYQFSA-N |
| XLogP | 5.02 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|