C14H11Cl2N3OS — CID 30279764
(E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 30279764) has the molecular formula C14H11Cl2N3OS and a molecular weight of 340.24 g/mol. Its IUPAC name is (E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30279764 |
| Molecular Formula | C14H11Cl2N3OS |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | (E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C14H11Cl2N3OS/c15-10-3-1-2-8(12(10)16)6-7-11(20)17-14-19-18-13(21-14)9-4-5-9/h1-3,6-7,9H,4-5H2,(H,17,19,20)/b7-6+ |
| InChIKey | JBIPUEILPMUUPR-VOTSOKGWSA-N |
| XLogP | 4.37 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|