C14H12FN3OS — CID 8502989
(E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 8502989) has the molecular formula C14H12FN3OS and a molecular weight of 289.33 g/mol. Its IUPAC name is (E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8502989 |
| Molecular Formula | C14H12FN3OS |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1F)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C14H12FN3OS/c15-11-4-2-1-3-9(11)7-8-12(19)16-14-18-17-13(20-14)10-5-6-10/h1-4,7-8,10H,5-6H2,(H,16,18,19)/b8-7+ |
| InChIKey | FYZHKIMGJZGZGD-BQYQJAHWSA-N |
| XLogP | 3.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|