C14H13N3OS — CID 6163871
(E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-phenylprop-2-enamide (PubChem CID 6163871) has the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. Its IUPAC name is (E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6163871 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (E)-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C14H13N3OS/c18-12(9-6-10-4-2-1-3-5-10)15-14-17-16-13(19-14)11-7-8-11/h1-6,9,11H,7-8H2,(H,15,17,18)/b9-6+ |
| InChIKey | WLYJOPGRNGWJAX-RMKNXTFCSA-N |
| XLogP | 3.07 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|