C12H11N3O2S — CID 4812428
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 4812428) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4812428 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C12H11N3O2S/c16-10(6-5-9-2-1-7-17-9)13-12-15-14-11(18-12)8-3-4-8/h1-2,5-8H,3-4H2,(H,13,15,16) |
| InChIKey | YSCHPYFLSDPIKM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|