C11H11N3O2S2 — CID 903368
(E)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 903368) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (E)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 903368 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | (E)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | CCSc1nnc(NC(=O)/C=C/c2ccco2)s1 |
| InChI | InChI=1S/C11H11N3O2S2/c1-2-17-11-14-13-10(18-11)12-9(15)6-5-8-4-3-7-16-8/h3-7H,2H2,1H3,(H,12,13,15)/b6-5+ |
| InChIKey | CTODNEXPZWOWTR-AATRIKPKSA-N |
| XLogP | 2.89 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|