C21H16ClFN4O2S — CID 17203493
(E)-3-(2-chlorophenyl)-N-[5-[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 17203493) has the molecular formula C21H16ClFN4O2S and a molecular weight of 442.90 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[5-[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[5-[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17203493 |
| Molecular Formula | C21H16ClFN4O2S |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[5-[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1nnc(C2CC(=O)N(c3ccc(F)cc3)C2)s1 |
| InChI | InChI=1S/C21H16ClFN4O2S/c22-17-4-2-1-3-13(17)5-10-18(28)24-21-26-25-20(30-21)14-11-19(29)27(12-14)16-8-6-15(23)7-9-16/h1-10,14H,11-12H2,(H,24,26,28)/b10-5+ |
| InChIKey | RBMAUQNBABAGFC-BJMVGYQFSA-N |
| XLogP | 4.50 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|