C14H10Cl4N4O2S — CID 17203625
2,2,2-trichloro-N-[5-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17203625) has the molecular formula C14H10Cl4N4O2S and a molecular weight of 440.14 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[5-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[5-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17203625 |
| Molecular Formula | C14H10Cl4N4O2S |
| Molecular Weight | 440.14 g/mol |
| Exact Mass | 437.93 |
| IUPAC Name | 2,2,2-trichloro-N-[5-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C1CC(c2nnc(NC(=O)C(Cl)(Cl)Cl)s2)CN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10Cl4N4O2S/c15-8-1-3-9(4-2-8)22-6-7(5-10(22)23)11-20-21-13(25-11)19-12(24)14(16,17)18/h1-4,7H,5-6H2,(H,19,21,24) |
| InChIKey | QUGKRZWWWAANKA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.14 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|