C17H21N5O2S — CID 509910
N-[5-(2-morpholin-4-ylethylamino)-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide (PubChem CID 509910) has the molecular formula C17H21N5O2S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[5-(2-morpholin-4-ylethylamino)-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[5-(2-morpholin-4-ylethylamino)-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 509910 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[5-(2-morpholin-4-ylethylamino)-1,3,4-thiadiazol-2-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1nnc(NCCN2CCOCC2)s1 |
| InChI | InChI=1S/C17H21N5O2S/c23-15(7-6-14-4-2-1-3-5-14)19-17-21-20-16(25-17)18-8-9-22-10-12-24-13-11-22/h1-7H,8-13H2,(H,18,20)(H,19,21,23) |
| InChIKey | HCSWUIJBZQRORY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|