C16H12N4OS — CID 744044
(E)-3-phenyl-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 744044) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is (E)-3-phenyl-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 744044 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (E)-3-phenyl-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1nnc(-c2ccncc2)s1 |
| InChI | InChI=1S/C16H12N4OS/c21-14(7-6-12-4-2-1-3-5-12)18-16-20-19-15(22-16)13-8-10-17-11-9-13/h1-11H,(H,18,20,21)/b7-6+ |
| InChIKey | UDVSFYDQACOJAI-VOTSOKGWSA-N |
| XLogP | 3.25 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|