C19H16ClN3O4S — CID 43975112
(E)-3-(2-chlorophenyl)-N-[5-[(4-methylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]prop-2-enamide (PubChem CID 43975112) has the molecular formula C19H16ClN3O4S and a molecular weight of 417.87 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[5-[(4-methylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[5-[(4-methylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 43975112 |
| Molecular Formula | C19H16ClN3O4S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[5-[(4-methylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(Cc2nnc(NC(=O)/C=C/c3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C19H16ClN3O4S/c1-28(25,26)15-9-6-13(7-10-15)12-18-22-23-19(27-18)21-17(24)11-8-14-4-2-3-5-16(14)20/h2-11H,12H2,1H3,(H,21,23,24)/b11-8+ |
| InChIKey | QFAHGDZGFMRGEE-DHZHZOJOSA-N |
| XLogP | 3.37 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|