C15H9Cl2N3O2S — CID 6012658
(E)-3-(2-chlorophenyl)-N-[5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enamide (PubChem CID 6012658) has the molecular formula C15H9Cl2N3O2S and a molecular weight of 366.23 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6012658 |
| Molecular Formula | C15H9Cl2N3O2S |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[5-(5-chlorothiophen-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1nnc(-c2ccc(Cl)s2)o1 |
| InChI | InChI=1S/C15H9Cl2N3O2S/c16-10-4-2-1-3-9(10)5-8-13(21)18-15-20-19-14(22-15)11-6-7-12(17)23-11/h1-8H,(H,18,20,21)/b8-5+ |
| InChIKey | VIGHYBAUBOSHTN-VMPITWQZSA-N |
| XLogP | 4.76 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|