C17H10Cl3N3O2 — CID 43976983
(E)-3-(2-chlorophenyl)-N-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide (PubChem CID 43976983) has the molecular formula C17H10Cl3N3O2 and a molecular weight of 394.65 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 43976983 |
| Molecular Formula | C17H10Cl3N3O2 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1nnc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C17H10Cl3N3O2/c18-11-6-7-12(14(20)9-11)16-22-23-17(25-16)21-15(24)8-5-10-3-1-2-4-13(10)19/h1-9H,(H,21,23,24)/b8-5+ |
| InChIKey | NIKISJORYGTARS-VMPITWQZSA-N |
| XLogP | 5.35 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|