C19H16ClN3O2 — CID 74908853
3-(2-chlorophenyl)-N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide (PubChem CID 74908853) has the molecular formula C19H16ClN3O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 74908853 |
| Molecular Formula | C19H16ClN3O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]prop-2-enamide |
| SMILES | Cc1cc(C)cc(-c2nnc(NC(=O)C=Cc3ccccc3Cl)o2)c1 |
| InChI | InChI=1S/C19H16ClN3O2/c1-12-9-13(2)11-15(10-12)18-22-23-19(25-18)21-17(24)8-7-14-5-3-4-6-16(14)20/h3-11H,1-2H3,(H,21,23,24) |
| InChIKey | MUNPKTUHLOTTBY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|