C15H9BrClN3O3 — CID 71962268
N-[5-(5-bromofuran-2-yl)-1,3,4-oxadiazol-2-yl]-3-(2-chlorophenyl)prop-2-enamide (PubChem CID 71962268) has the molecular formula C15H9BrClN3O3 and a molecular weight of 394.61 g/mol. Its IUPAC name is N-[5-(5-bromofuran-2-yl)-1,3,4-oxadiazol-2-yl]-3-(2-chlorophenyl)prop-2-enamide.
| Compound Name | N-[5-(5-bromofuran-2-yl)-1,3,4-oxadiazol-2-yl]-3-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 71962268 |
| Molecular Formula | C15H9BrClN3O3 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | N-[5-(5-bromofuran-2-yl)-1,3,4-oxadiazol-2-yl]-3-(2-chlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)Nc1nnc(-c2ccc(Br)o2)o1 |
| InChI | InChI=1S/C15H9BrClN3O3/c16-12-7-6-11(22-12)14-19-20-15(23-14)18-13(21)8-5-9-3-1-2-4-10(9)17/h1-8H,(H,18,20,21) |
| InChIKey | ODMVLZBHIFMWED-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|