C13H16BrNO3S — CID 51108653
(E)-3-(2-bromophenyl)-N-(2-ethylsulfonylethyl)prop-2-enamide (PubChem CID 51108653) has the molecular formula C13H16BrNO3S and a molecular weight of 346.25 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-N-(2-ethylsulfonylethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-bromophenyl)-N-(2-ethylsulfonylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 51108653 |
| Molecular Formula | C13H16BrNO3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | (E)-3-(2-bromophenyl)-N-(2-ethylsulfonylethyl)prop-2-enamide |
| SMILES | CCS(=O)(=O)CCNC(=O)/C=C/c1ccccc1Br |
| InChI | InChI=1S/C13H16BrNO3S/c1-2-19(17,18)10-9-15-13(16)8-7-11-5-3-4-6-12(11)14/h3-8H,2,9-10H2,1H3,(H,15,16)/b8-7+ |
| InChIKey | MJTJLIRXCQXOMX-BQYQJAHWSA-N |
| XLogP | 2.01 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|