C26H25N5O3S — CID 31304316
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide (PubChem CID 31304316) has the molecular formula C26H25N5O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 31304316 |
| Molecular Formula | C26H25N5O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C26H25N5O3S/c27-35(33,34)24-11-8-20(9-12-24)14-16-29-25(32)13-10-23-19-31(18-21-5-2-1-3-6-21)30-26(23)22-7-4-15-28-17-22/h1-13,15,17,19H,14,16,18H2,(H,29,32)(H2,27,33,34)/b13-10+ |
| InChIKey | MSUSYBLYHHQXKY-JLHYYAGUSA-N |
| XLogP | 3.01 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|