C21H22N4O — CID 134005696
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-ethyl-N-methylprop-2-enamide (PubChem CID 134005696) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-ethyl-N-methylprop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-ethyl-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 134005696 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-ethyl-N-methylprop-2-enamide |
| SMILES | CCN(C)C(=O)/C=C/c1cn(Cc2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C21H22N4O/c1-3-24(2)20(26)12-11-19-16-25(15-17-8-5-4-6-9-17)23-21(19)18-10-7-13-22-14-18/h4-14,16H,3,15H2,1-2H3/b12-11+ |
| InChIKey | COKNKTDMUFXXGR-VAWYXSNFSA-N |
| XLogP | 3.48 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|