C25H22N4OS — CID 37289245
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-(4-methylsulfanylphenyl)prop-2-enamide (PubChem CID 37289245) has the molecular formula C25H22N4OS and a molecular weight of 426.55 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-(4-methylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-(4-methylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 37289245 |
| Molecular Formula | C25H22N4OS |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-(4-methylsulfanylphenyl)prop-2-enamide |
| SMILES | CSc1ccc(NC(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C25H22N4OS/c1-31-23-12-10-22(11-13-23)27-24(30)14-9-21-18-29(17-19-6-3-2-4-7-19)28-25(21)20-8-5-15-26-16-20/h2-16,18H,17H2,1H3,(H,27,30)/b14-9+ |
| InChIKey | LKOWQUQUDDZOBO-NTEUORMPSA-N |
| XLogP | 5.37 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|