C30H32N6O — CID 39727327
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 39727327) has the molecular formula C30H32N6O and a molecular weight of 492.63 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 39727327 |
| Molecular Formula | C30H32N6O |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2cccnc2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C30H32N6O/c1-23-19-27(11-12-28(23)35-17-15-34(2)16-18-35)32-29(37)13-10-26-22-36(21-24-7-4-3-5-8-24)33-30(26)25-9-6-14-31-20-25/h3-14,19-20,22H,15-18,21H2,1-2H3,(H,32,37)/b13-10+ |
| InChIKey | ADKUHJQFVNEARJ-JLHYYAGUSA-N |
| XLogP | 4.71 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|