C27H26N6O2 — CID 60576653
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-(2-morpholin-4-yl-3-pyridinyl)prop-2-enamide (PubChem CID 60576653) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-(2-morpholin-4-yl-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-(2-morpholin-4-yl-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 60576653 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-(2-morpholin-4-yl-3-pyridinyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nc1-c1cccnc1)Nc1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C27H26N6O2/c34-25(30-24-9-5-13-29-27(24)32-14-16-35-17-15-32)11-10-23-20-33(19-21-6-2-1-3-7-21)31-26(23)22-8-4-12-28-18-22/h1-13,18,20H,14-17,19H2,(H,30,34)/b11-10+ |
| InChIKey | ULGZGJUWODKLOK-ZHACJKMWSA-N |
| XLogP | 3.88 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|