C30H31N5O2 — CID 134049566
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 134049566) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 134049566 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nc1-c1cccnc1)NCc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C30H31N5O2/c36-29(32-20-25-9-4-5-10-27(25)22-34-15-17-37-18-16-34)13-12-28-23-35(21-24-7-2-1-3-8-24)33-30(28)26-11-6-14-31-19-26/h1-14,19,23H,15-18,20-22H2,(H,32,36)/b13-12+ |
| InChIKey | XYUOIYDNFZUAGT-OUKQBFOZSA-N |
| XLogP | 4.16 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|