C25H21ClN4O — CID 46635194
(E)-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 46635194) has the molecular formula C25H21ClN4O and a molecular weight of 428.92 g/mol. Its IUPAC name is (E)-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 46635194 |
| Molecular Formula | C25H21ClN4O |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (E)-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2Cl)nc1-c1ccccc1)NCc1cccnc1 |
| InChI | InChI=1S/C25H21ClN4O/c26-23-11-5-4-10-21(23)17-30-18-22(25(29-30)20-8-2-1-3-9-20)12-13-24(31)28-16-19-7-6-14-27-15-19/h1-15,18H,16-17H2,(H,28,31)/b13-12+ |
| InChIKey | DPBSLIAIBGRNOJ-OUKQBFOZSA-N |
| XLogP | 4.98 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|