C26H27ClN4O2 — CID 46564913
(E)-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-N-(3-oxo-3-pyrrolidin-1-ylpropyl)prop-2-enamide (PubChem CID 46564913) has the molecular formula C26H27ClN4O2 and a molecular weight of 462.98 g/mol. Its IUPAC name is (E)-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-N-(3-oxo-3-pyrrolidin-1-ylpropyl)prop-2-enamide.
| Compound Name | (E)-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-N-(3-oxo-3-pyrrolidin-1-ylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 46564913 |
| Molecular Formula | C26H27ClN4O2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (E)-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]-N-(3-oxo-3-pyrrolidin-1-ylpropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2Cl)nc1-c1ccccc1)NCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C26H27ClN4O2/c27-23-11-5-4-10-21(23)18-31-19-22(26(29-31)20-8-2-1-3-9-20)12-13-24(32)28-15-14-25(33)30-16-6-7-17-30/h1-5,8-13,19H,6-7,14-18H2,(H,28,32)/b13-12+ |
| InChIKey | ZIZQNBDSLVWVKL-OUKQBFOZSA-N |
| XLogP | 4.39 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|