C23H24N4O2 — CID 9489284
(E)-3-(1-benzyl-3-phenylpyrazol-4-yl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 9489284) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9489284 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | CCNC(=O)CNC(=O)/C=C/c1cn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H24N4O2/c1-2-24-22(29)15-25-21(28)14-13-20-17-27(16-18-9-5-3-6-10-18)26-23(20)19-11-7-4-8-12-19/h3-14,17H,2,15-16H2,1H3,(H,24,29)(H,25,28)/b14-13+ |
| InChIKey | JWLVGABBFJXTPG-BUHFOSPRSA-N |
| XLogP | 2.86 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|