C28H33N5O2 — CID 98715989
2-[4-[(E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoyl]-1,4-diazepan-1-yl]-N-ethylacetamide (PubChem CID 98715989) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 2-[4-[(E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoyl]-1,4-diazepan-1-yl]-N-ethylacetamide.
| Compound Name | 2-[4-[(E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoyl]-1,4-diazepan-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 98715989 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-[4-[(E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoyl]-1,4-diazepan-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1CCCN(C(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N5O2/c1-2-29-26(34)22-31-16-9-17-32(19-18-31)27(35)15-14-25-21-33(20-23-10-5-3-6-11-23)30-28(25)24-12-7-4-8-13-24/h3-8,10-15,21H,2,9,16-20,22H2,1H3,(H,29,34)/b15-14+ |
| InChIKey | VGKZUYORSUIPRI-CCEZHUSRSA-N |
| XLogP | 3.28 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|