C29H34N6O2 — CID 55466452
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-1-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 55466452) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-1-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-1-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55466452 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-1-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nc1-c1cccnc1)N1CCN(CC(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C29H34N6O2/c36-27(34-18-16-32(17-19-34)23-28(37)33-14-5-2-6-15-33)12-11-26-22-35(21-24-8-3-1-4-9-24)31-29(26)25-10-7-13-30-20-25/h1,3-4,7-13,20,22H,2,5-6,14-19,21,23H2/b12-11+ |
| InChIKey | AGPFKDQPGKTMRY-VAWYXSNFSA-N |
| XLogP | 3.16 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|