C23H26N4O — CID 24680908
(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-pentan-3-ylprop-2-enamide (PubChem CID 24680908) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-pentan-3-ylprop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-pentan-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 24680908 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-pentan-3-ylprop-2-enamide |
| SMILES | CCC(CC)NC(=O)/C=C/c1cn(Cc2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C23H26N4O/c1-3-21(4-2)25-22(28)13-12-20-17-27(16-18-9-6-5-7-10-18)26-23(20)19-11-8-14-24-15-19/h5-15,17,21H,3-4,16H2,1-2H3,(H,25,28)/b13-12+ |
| InChIKey | MTSSXLRHJKBZQP-OUKQBFOZSA-N |
| XLogP | 4.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|