C25H20FN5O2 — CID 31304372
N'-[(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]-2-fluorobenzohydrazide (PubChem CID 31304372) has the molecular formula C25H20FN5O2 and a molecular weight of 441.47 g/mol. Its IUPAC name is N'-[(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 31304372 |
| Molecular Formula | C25H20FN5O2 |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N'-[(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]-2-fluorobenzohydrazide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nc1-c1cccnc1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C25H20FN5O2/c26-22-11-5-4-10-21(22)25(33)29-28-23(32)13-12-20-17-31(16-18-7-2-1-3-8-18)30-24(20)19-9-6-14-27-15-19/h1-15,17H,16H2,(H,28,32)(H,29,33)/b13-12+ |
| InChIKey | XRWVOFMZHXYDFK-OUKQBFOZSA-N |
| XLogP | 3.61 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|