C24H18FN5O2 — CID 26799380
2-fluoro-N'-[(E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]benzohydrazide (PubChem CID 26799380) has the molecular formula C24H18FN5O2 and a molecular weight of 427.44 g/mol. Its IUPAC name is 2-fluoro-N'-[(E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[(E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 26799380 |
| Molecular Formula | C24H18FN5O2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-fluoro-N'-[(E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C24H18FN5O2/c25-21-11-5-4-10-20(21)24(32)28-27-22(31)13-12-18-16-30(19-8-2-1-3-9-19)29-23(18)17-7-6-14-26-15-17/h1-16H,(H,27,31)(H,28,32)/b13-12+ |
| InChIKey | MQMMOCQLVYJWHY-OUKQBFOZSA-N |
| XLogP | 3.55 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|