C24H26N4O3S — CID 46798575
ethyl 4-[(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 46798575) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is ethyl 4-[(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46798575 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | ethyl 4-[(E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2cccs2)CC1 |
| InChI | InChI=1S/C24H26N4O3S/c1-2-31-24(30)27-14-12-26(13-15-27)22(29)11-10-20-18-28(17-19-7-4-3-5-8-19)25-23(20)21-9-6-16-32-21/h3-11,16,18H,2,12-15,17H2,1H3/b11-10+ |
| InChIKey | KOBKFEPBPBELLA-ZHACJKMWSA-N |
| XLogP | 3.97 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|