C24H25N3O3S — CID 3313271
ethyl 1-[3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 3313271) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is ethyl 1-[3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3313271 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | ethyl 1-[3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C=Cc2cn(-c3ccccc3)nc2-c2cccs2)CC1 |
| InChI | InChI=1S/C24H25N3O3S/c1-2-30-24(29)18-12-14-26(15-13-18)22(28)11-10-19-17-27(20-7-4-3-5-8-20)25-23(19)21-9-6-16-31-21/h3-11,16-18H,2,12-15H2,1H3 |
| InChIKey | ZFSKVCWQFLLXKL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|